C58H77N2+ — CID 162702956
(2E)-1-ethyl-2-[(E)-3-[1-ethyl-3,3-dimethyl-5-(7-methyl-9,9-dioctylfluoren-2-yl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindole (PubChem CID 162702956) has the molecular formula C58H77N2+ and a molecular weight of 802.27 g/mol. Its IUPAC name is (2E)-1-ethyl-2-[(E)-3-[1-ethyl-3,3-dimethyl-5-(7-methyl-9,9-dioctylfluoren-2-yl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindole.
| Compound Name | (2E)-1-ethyl-2-[(E)-3-[1-ethyl-3,3-dimethyl-5-(7-methyl-9,9-dioctylfluoren-2-yl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindole |
|---|---|
| PubChem CID | 162702956 |
| Molecular Formula | C58H77N2+ |
| Molecular Weight | 802.27 g/mol |
| Exact Mass | 801.61 |
| IUPAC Name | (2E)-1-ethyl-2-[(E)-3-[1-ethyl-3,3-dimethyl-5-(7-methyl-9,9-dioctylfluoren-2-yl)indol-1-ium-2-yl]prop-2-enylidene]-3,3,5-trimethylindole |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc4c(c3)C(C)(C)C(/C=C/C=C3/N(CC)c5ccc(C)cc5C3(C)C)=[N+]4CC)cc21 |
| InChI | InChI=1S/C58H77N2/c1-11-15-17-19-21-23-36-58(37-24-22-20-18-16-12-2)48-38-42(5)28-32-46(48)47-33-30-44(40-49(47)58)45-31-35-53-51(41-45)57(9,10)55(60(53)14-4)27-25-26-54-56(7,8)50-39-43(6)29-34-52(50)59(54)13-3/h25-35,38-41H,11-24,36-37H2,1-10H3/q+1 |
| InChIKey | YHUJKPWOQHLXSF-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.27 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|