C12H20N4O3 — CID 162703971
tert-butyl N-[[5-carbamoyl-1-(trideuteriomethyl)pyrazol-3-yl]methyl]-N-methylcarbamate (PubChem CID 162703971) has the molecular formula C12H20N4O3 and a molecular weight of 271.34 g/mol. Its IUPAC name is tert-butyl N-[[5-carbamoyl-1-(trideuteriomethyl)pyrazol-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[5-carbamoyl-1-(trideuteriomethyl)pyrazol-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 162703971 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | tert-butyl N-[[5-carbamoyl-1-(trideuteriomethyl)pyrazol-3-yl]methyl]-N-methylcarbamate |
| SMILES | [2H]C([2H])([2H])n1nc(CN(C)C(=O)OC(C)(C)C)cc1C(N)=O |
| InChI | InChI=1S/C12H20N4O3/c1-12(2,3)19-11(18)15(4)7-8-6-9(10(13)17)16(5)14-8/h6H,7H2,1-5H3,(H2,13,17)/i5D3 |
| InChIKey | WNVBTEJFIHFYRT-VPYROQPTSA-N |
| XLogP | 0.89 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |