C42H43FN4O7 — CID 162704245
(2R)-N-[4-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 162704245) has the molecular formula C42H43FN4O7 and a molecular weight of 734.82 g/mol. Its IUPAC name is (2R)-N-[4-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | (2R)-N-[4-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 162704245 |
| Molecular Formula | C42H43FN4O7 |
| Molecular Weight | 734.82 g/mol |
| Exact Mass | 734.31 |
| IUPAC Name | (2R)-N-[4-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(OCCOCCCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C42H43FN4O7/c1-25(26-7-9-27(10-8-26)32-19-20-44-35-16-11-29(43)24-34(32)35)39(49)45-30-12-14-31(15-13-30)54-23-22-53-21-3-5-28-4-2-6-33-38(28)42(52)47(41(33)51)36-17-18-37(48)46-40(36)50/h2,4,6,11-16,19-20,24-27,36H,3,5,7-10,17-18,21-23H2,1H3,(H,45,49)(H,46,48,50)/t25-,26?,27?,36?/m1/s1 |
| InChIKey | NCCJGNLSOCEHMT-GYZGZUMBSA-N |
| XLogP | 6.35 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.82 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|