C17H21N3O2 — CID 162704756
5-cyclopropyl-3-[4-(oxiran-2-ylmethoxy)phenyl]-1-propan-2-yl-1,2,4-triazole (PubChem CID 162704756) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 5-cyclopropyl-3-[4-(oxiran-2-ylmethoxy)phenyl]-1-propan-2-yl-1,2,4-triazole.
| Compound Name | 5-cyclopropyl-3-[4-(oxiran-2-ylmethoxy)phenyl]-1-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 162704756 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 5-cyclopropyl-3-[4-(oxiran-2-ylmethoxy)phenyl]-1-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1nc(-c2ccc(OCC3CO3)cc2)nc1C1CC1 |
| InChI | InChI=1S/C17H21N3O2/c1-11(2)20-17(13-3-4-13)18-16(19-20)12-5-7-14(8-6-12)21-9-15-10-22-15/h5-8,11,13,15H,3-4,9-10H2,1-2H3 |
| InChIKey | QQRQNIMSRGYXIU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|