C24H26N4O3S — CID 162705210
N-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 162705210) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 162705210 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[5-[1-(4-ethylphenyl)pyrazol-4-yl]-1H-indol-3-yl]-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | CCc1ccc(-n2cc(-c3ccc4[nH]cc(NS(=O)(=O)CC5CCCO5)c4c3)cn2)cc1 |
| InChI | InChI=1S/C24H26N4O3S/c1-2-17-5-8-20(9-6-17)28-15-19(13-26-28)18-7-10-23-22(12-18)24(14-25-23)27-32(29,30)16-21-4-3-11-31-21/h5-10,12-15,21,25,27H,2-4,11,16H2,1H3 |
| InChIKey | XYKNNRITIWQLQR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |