C15H19N3O3S — CID 95344226
1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-4-sulfonamide (PubChem CID 95344226) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 95344226 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-4-sulfonamide |
| SMILES | Cc1ccc(-n2cc(S(=O)(=O)NC[C@H]3CCCO3)cn2)cc1 |
| InChI | InChI=1S/C15H19N3O3S/c1-12-4-6-13(7-5-12)18-11-15(10-16-18)22(19,20)17-9-14-3-2-8-21-14/h4-7,10-11,14,17H,2-3,8-9H2,1H3/t14-/m1/s1 |
| InChIKey | YCCVQVMQBUYDJQ-CQSZACIVSA-N |
| XLogP | 1.64 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |