C11H14ClN5O2 — CID 162705449
2-chloro-7-[2-(2,2-dideuteriomorpholin-4-yl)ethyl]-1H-purin-6-one (PubChem CID 162705449) has the molecular formula C11H14ClN5O2 and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-chloro-7-[2-(2,2-dideuteriomorpholin-4-yl)ethyl]-1H-purin-6-one.
| Compound Name | 2-chloro-7-[2-(2,2-dideuteriomorpholin-4-yl)ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 162705449 |
| Molecular Formula | C11H14ClN5O2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-chloro-7-[2-(2,2-dideuteriomorpholin-4-yl)ethyl]-1H-purin-6-one |
| SMILES | [2H]C1([2H])CN(CCn2cnc3nc(Cl)[nH]c(=O)c32)CCO1 |
| InChI | InChI=1S/C11H14ClN5O2/c12-11-14-9-8(10(18)15-11)17(7-13-9)2-1-16-3-5-19-6-4-16/h7H,1-6H2,(H,14,15,18)/i5D2 |
| InChIKey | WDWRIFZJGZRENB-BFWBPSQCSA-N |
| XLogP | 0.11 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |