C42H32IrN2O-2 — CID 162707327
iridium;2-(9H-naphtho[2,1-b][1]benzofuran-9-id-8-yl)-4-(2-phenylpropan-2-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 162707327) has the molecular formula C42H32IrN2O-2 and a molecular weight of 775.97 g/mol. Its IUPAC name is iridium;2-(9H-naphtho[2,1-b][1]benzofuran-9-id-8-yl)-4-(2-phenylpropan-2-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | iridium;2-(9H-naphtho[2,1-b][1]benzofuran-9-id-8-yl)-4-(2-phenylpropan-2-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 162707327 |
| Molecular Formula | C42H32IrN2O-2 |
| Molecular Weight | 775.97 g/mol |
| Exact Mass | 776.23 |
| IUPAC Name | iridium;2-(9H-naphtho[2,1-b][1]benzofuran-9-id-8-yl)-4-(2-phenylpropan-2-yl)pyridine;2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | CC(C)(c1ccccc1)c1ccnc(-c2[c-]ccc3c2oc2ccc4ccccc4c23)c1.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C30H22NO.C12H10N.Ir/c1-30(2,21-10-4-3-5-11-21)22-17-18-31-26(19-22)24-13-8-14-25-28-23-12-7-6-9-20(23)15-16-27(28)32-29(24)25;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h3-12,14-19H,1-2H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | VGFUEFZNQFQYMQ-ICMJTWPQSA-N |
| XLogP | 10.78 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.97 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|