C51H44IrN2OSi-2 — CID 162709282
iridium;3-[1-(2-phenylpropan-2-yl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane (PubChem CID 162709282) has the molecular formula C51H44IrN2OSi-2 and a molecular weight of 924.25 g/mol. Its IUPAC name is iridium;3-[1-(2-phenylpropan-2-yl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane.
| Compound Name | iridium;3-[1-(2-phenylpropan-2-yl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
|---|---|
| PubChem CID | 162709282 |
| Molecular Formula | C51H44IrN2OSi-2 |
| Molecular Weight | 924.25 g/mol |
| Exact Mass | 924.31 |
| IUPAC Name | iridium;3-[1-(2-phenylpropan-2-yl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
| SMILES | CC(C)(c1ccccc1)c1c[c-]c(-c2cc3ccccc3cn2)c2oc3ccccc3c12.[2H]C([2H])([2H])c1c[c-]c(-c2cc(-c3ccccc3)c([Si](C)(C)C)cn2)cc1.[Ir] |
| InChI | InChI=1S/C30H22NO.C21H22NSi.Ir/c1-30(2,22-12-4-3-5-13-22)25-17-16-23(26-18-20-10-6-7-11-21(20)19-31-26)29-28(25)24-14-8-9-15-27(24)32-29;1-16-10-12-18(13-11-16)20-14-19(17-8-6-5-7-9-17)21(15-22-20)23(2,3)4;/h3-15,17-19H,1-2H3;5-12,14-15H,1-4H3;/q2*-1;/i;1D3; |
| InChIKey | WWYRRSLLAVUBOP-ICMJTWPQSA-N |
| XLogP | 12.99 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.25 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|