C47H46IrN2OSi-2 — CID 176873897
CID 176873897 (PubChem CID 176873897) has the molecular formula C47H46IrN2OSi-2 and a molecular weight of 883.25 g/mol.
| Compound Name | CID 176873897 |
|---|---|
| PubChem CID | 176873897 |
| Molecular Formula | C47H46IrN2OSi-2 |
| Molecular Weight | 883.25 g/mol |
| Exact Mass | 883.35 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])(C)C)c([Si](C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])(C)C)ccn2)c2oc3cc4c(ccc5ccccc54)cc3c12.[Ir] |
| InChI | InChI=1S/C29H22NO.C18H24NSi.Ir/c1-17(2)20-12-13-30-26(15-20)23-11-8-18(3)28-25-14-21-10-9-19-6-4-5-7-22(19)24(21)16-27(25)31-29(23)28;1-13(2)16-11-17(15-9-7-14(3)8-10-15)19-12-18(16)20(4,5)6;/h4-10,12-17H,1-3H3;7-9,11-13H,1-6H3;/q2*-1;/i3D3,17D;3D3,13D; |
| InChIKey | ZONXCURHMKSHNQ-CKBQOFMLSA-N |
| XLogP | 12.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.25 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|