C48H46IrN2OSi-2 — CID 176873924
CID 176873924 (PubChem CID 176873924) has the molecular formula C48H46IrN2OSi-2 and a molecular weight of 888.22 g/mol.
| Compound Name | CID 176873924 |
|---|---|
| PubChem CID | 176873924 |
| Molecular Formula | C48H46IrN2OSi-2 |
| Molecular Weight | 888.22 g/mol |
| Exact Mass | 888.31 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]cc(C3CCCCC3)c3c2oc2cc4c(ccc5ccccc54)cc23)c1.[Ir] |
| InChI | InChI=1S/C34H30NO.C14H16NSi.Ir/c1-21(2)24-16-17-35-31(19-24)28-15-14-27(22-8-4-3-5-9-22)33-30-18-25-13-12-23-10-6-7-11-26(23)29(25)20-32(30)36-34(28)33;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h6-7,10-14,16-22H,3-5,8-9H2,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i21D;; |
| InChIKey | CVDRQDLNNVEKHM-LZNRWZRQSA-N |
| XLogP | 13.02 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.22 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|