About CID 176873905
CID 176873905 (PubChem CID 176873905) has the molecular formula C45H42IrN2OSi-2
and a molecular weight of 849.16 g/mol.
Molecular Properties
| Compound Name | CID 176873905 |
| PubChem CID | 176873905 |
| Molecular Formula | C45H42IrN2OSi-2 |
| Molecular Weight | 849.16 g/mol |
| Exact Mass | 849.28 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]cc(C([2H])(C)C)c3c2oc2cc4c(ccc5ccccc54)cc23)c1.[Ir] |
| InChI | InChI=1S/C31H26NO.C14H16NSi.Ir/c1-18(2)21-13-14-32-28(16-21)25-12-11-23(19(3)4)30-27-15-22-10-9-20-7-5-6-8-24(20)26(22)17-29(27)33-31(25)30;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h5-11,13-19H,1-4H3;4-7,9-11H,1-3H3;/q2*-1;/i18D,19D;; |
| InChIKey | YPUYYRIBMVUGNR-HRLVLXFZSA-N |
| XLogP | 12.09 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 849.16 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176873905 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176873905?
The IUPAC name of CID 176873905 (CID 176873905) is not available.
What is the SMILES notation for CID 176873905?
The canonical SMILES for CID 176873905 is C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C(C)(C)c1ccnc(-c2[c-]cc(C([2H])(C)C)c3c2oc2cc4c(ccc5ccccc54)cc23)c1.[Ir].
What is the InChIKey of CID 176873905?
The InChIKey is YPUYYRIBMVUGNR-HRLVLXFZSA-N. The full InChI is InChI=1S/C31H26NO.C14H16NSi.Ir/c1-18(2)21-13-14-32-28(16-21)25-12-11-23(19(3)4)30-27-15-22-10-9-20-7-5-6-8-24(20)26(22)17-29(27)33-31(25)30;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h5-11,13-19H,1-4H3;4-7,9-11H,1-3H3;/q2*-1;/i18D,19D;;.
What are the key properties of CID 176873905?
CID 176873905 has a molecular weight of 849.16 g/mol, XLogP of 12.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176873905 is sourced from PubChem (CID 176873905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).