About CID 176873974
CID 176873974 (PubChem CID 176873974) has the molecular formula C48H48IrN2OSi-2
and a molecular weight of 894.26 g/mol.
Molecular Properties
| Compound Name | CID 176873974 |
| PubChem CID | 176873974 |
| Molecular Formula | C48H48IrN2OSi-2 |
| Molecular Weight | 894.26 g/mol |
| Exact Mass | 894.35 |
| IUPAC Name | — |
| SMILES | [2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])(CC)CC)ccn2)c2oc3cc4c(ccc5ccccc54)cc3c12.[Ir] |
| InChI | InChI=1S/C31H26NO.C17H22NSi.Ir/c1-4-20(5-2)22-14-15-32-28(17-22)25-13-10-19(3)30-27-16-23-12-11-21-8-6-7-9-24(21)26(23)18-29(27)33-31(25)30;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h6-12,14-18,20H,4-5H2,1-3H3;6-9,11-13H,1-5H3;/q2*-1;/i3D3,20D;13D; |
| InChIKey | ZENSODNRSPRLJT-YIKAYBFVSA-N |
| XLogP | 13.18 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 894.26 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176873974 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176873974?
The IUPAC name of CID 176873974 (CID 176873974) is not available.
What is the SMILES notation for CID 176873974?
The canonical SMILES for CID 176873974 is [2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])(CC)CC)ccn2)c2oc3cc4c(ccc5ccccc54)cc3c12.[Ir].
What is the InChIKey of CID 176873974?
The InChIKey is ZENSODNRSPRLJT-YIKAYBFVSA-N. The full InChI is InChI=1S/C31H26NO.C17H22NSi.Ir/c1-4-20(5-2)22-14-15-32-28(17-22)25-13-10-19(3)30-27-16-23-12-11-21-8-6-7-9-24(21)26(23)18-29(27)33-31(25)30;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h6-12,14-18,20H,4-5H2,1-3H3;6-9,11-13H,1-5H3;/q2*-1;/i3D3,20D;13D;.
What are the key properties of CID 176873974?
CID 176873974 has a molecular weight of 894.26 g/mol, XLogP of 13.18, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176873974 is sourced from PubChem (CID 176873974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).