C48H42IrN2O3Si-2 — CID 176873979
CID 176873979 (PubChem CID 176873979) has the molecular formula C48H42IrN2O3Si-2 and a molecular weight of 919.20 g/mol.
| Compound Name | CID 176873979 |
|---|---|
| PubChem CID | 176873979 |
| Molecular Formula | C48H42IrN2O3Si-2 |
| Molecular Weight | 919.20 g/mol |
| Exact Mass | 919.29 |
| IUPAC Name | — |
| SMILES | [2H]C(C)(C)c1cc(-c2[c-]ccc(-c3ccccc3)c2)ncc1[Si](C)(C)C.[2H]C([2H])([2H])c1c[c-]c(-c2cc(OC)ccn2)c2oc3c(ccc4c5ccccc5oc43)c12.[Ir] |
| InChI | InChI=1S/C25H16NO3.C23H26NSi.Ir/c1-14-7-8-18(20-13-15(27-2)11-12-26-20)23-22(14)19-10-9-17-16-5-3-4-6-21(16)28-24(17)25(19)29-23;1-17(2)21-15-22(24-16-23(21)25(3,4)5)20-13-9-12-19(14-20)18-10-7-6-8-11-18;/h3-7,9-13H,1-2H3;6-12,14-17H,1-5H3;/q2*-1;/i1D3;17D; |
| InChIKey | MYTNLGSRHBFJLQ-MCHVKJJBSA-N |
| XLogP | 12.55 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.20 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|