C46H44IrN2SSi-2 — CID 176873939
CID 176873939 (PubChem CID 176873939) has the molecular formula C46H44IrN2SSi-2 and a molecular weight of 882.27 g/mol.
| Compound Name | CID 176873939 |
|---|---|
| PubChem CID | 176873939 |
| Molecular Formula | C46H44IrN2SSi-2 |
| Molecular Weight | 882.27 g/mol |
| Exact Mass | 882.29 |
| IUPAC Name | — |
| SMILES | [2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])(C)C)ccn2)c2sc3cc4c(ccc5ccccc54)cc3c12.[Ir] |
| InChI | InChI=1S/C29H22NS.C17H22NSi.Ir/c1-17(2)20-12-13-30-26(15-20)23-11-8-18(3)28-25-14-21-10-9-19-6-4-5-7-22(19)24(21)16-27(25)31-29(23)28;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h4-10,12-17H,1-3H3;6-9,11-13H,1-5H3;/q2*-1;/i3D3,17D;13D; |
| InChIKey | DSXIFMUAYJSERJ-FYTCABQTSA-N |
| XLogP | 12.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.27 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|