C43H42IrN2SSi-2 — CID 165170813
4-(2-deuteriopropan-2-yl)-2-[7-(2,6-dimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane (PubChem CID 165170813) has the molecular formula C43H42IrN2SSi-2 and a molecular weight of 840.20 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-[7-(2,6-dimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-[7-(2,6-dimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 165170813 |
| Molecular Formula | C43H42IrN2SSi-2 |
| Molecular Weight | 840.20 g/mol |
| Exact Mass | 840.25 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-[7-(2,6-dimethylphenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2sc2cc(-c4c(C)cccc4C)ccc23)c1.[Ir] |
| InChI | InChI=1S/C28H24NS.C15H18NSi.Ir/c1-17(2)20-13-14-29-25(15-20)24-10-6-9-23-22-12-11-21(16-26(22)30-28(23)24)27-18(3)7-5-8-19(27)4;1-12-10-14(13-8-6-5-7-9-13)16-11-15(12)17(2,3)4;/h5-9,11-17H,1-4H3;5-8,10-11H,1-4H3;/q2*-1;/i17D;; |
| InChIKey | GUUQSSPZFHWSJN-SMYCVDIJSA-N |
| XLogP | 11.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.20 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|