C44H45IrN3SSi-2 — CID 165170695
4,5-bis(2-deuteriopropan-2-yl)-2-[7-(6-methyl-2-pyridinyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane (PubChem CID 165170695) has the molecular formula C44H45IrN3SSi-2 and a molecular weight of 870.25 g/mol. Its IUPAC name is 4,5-bis(2-deuteriopropan-2-yl)-2-[7-(6-methyl-2-pyridinyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane.
| Compound Name | 4,5-bis(2-deuteriopropan-2-yl)-2-[7-(6-methyl-2-pyridinyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 165170695 |
| Molecular Formula | C44H45IrN3SSi-2 |
| Molecular Weight | 870.25 g/mol |
| Exact Mass | 870.29 |
| IUPAC Name | 4,5-bis(2-deuteriopropan-2-yl)-2-[7-(6-methyl-2-pyridinyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[2H]C(C)(C)c1cnc(-c2[c-]ccc3c2sc2cc(-c4cccc(C)n4)ccc23)cc1C([2H])(C)C.[Ir] |
| InChI | InChI=1S/C29H27N2S.C15H18NSi.Ir/c1-17(2)24-15-27(30-16-25(24)18(3)4)23-10-7-9-22-21-13-12-20(14-28(21)32-29(22)23)26-11-6-8-19(5)31-26;1-12-10-14(13-8-6-5-7-9-13)16-11-15(12)17(2,3)4;/h6-9,11-18H,1-5H3;5-8,10-11H,1-4H3;/q2*-1;/i17D,18D;; |
| InChIKey | OPUSLRYNCJTSLA-GXIIUUAHSA-N |
| XLogP | 11.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.25 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|