C35H33FIrN2SSi-2 — CID 165170984
4-(2-deuteriopropan-2-yl)-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane (PubChem CID 165170984) has the molecular formula C35H33FIrN2SSi-2 and a molecular weight of 754.04 g/mol. Its IUPAC name is 4-(2-deuteriopropan-2-yl)-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-(2-deuteriopropan-2-yl)-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 165170984 |
| Molecular Formula | C35H33FIrN2SSi-2 |
| Molecular Weight | 754.04 g/mol |
| Exact Mass | 754.18 |
| IUPAC Name | 4-(2-deuteriopropan-2-yl)-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)silane |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[2H]C(C)(C)c1ccnc(-c2[c-]ccc3c2sc2cc(F)ccc23)c1.[Ir] |
| InChI | InChI=1S/C20H15FNS.C15H18NSi.Ir/c1-12(2)13-8-9-22-18(10-13)17-5-3-4-16-15-7-6-14(21)11-19(15)23-20(16)17;1-12-10-14(13-8-6-5-7-9-13)16-11-15(12)17(2,3)4;/h3-4,6-12H,1-2H3;5-8,10-11H,1-4H3;/q2*-1;/i12D;; |
| InChIKey | XGQUBAJCXBUVSP-USJWNWRASA-N |
| XLogP | 9.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.04 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|