C45H37FIrN2SSi-2 — CID 162708139
4-benzyl-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;(4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium (PubChem CID 162708139) has the molecular formula C45H37FIrN2SSi-2 and a molecular weight of 877.17 g/mol. Its IUPAC name is 4-benzyl-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;(4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium.
| Compound Name | 4-benzyl-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;(4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium |
|---|---|
| PubChem CID | 162708139 |
| Molecular Formula | C45H37FIrN2SSi-2 |
| Molecular Weight | 877.17 g/mol |
| Exact Mass | 877.21 |
| IUPAC Name | 4-benzyl-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)pyridine;(4-benzyl-6-phenyl-3-pyridinyl)-trimethylsilane;iridium |
| SMILES | C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1Cc1ccccc1.Fc1ccc2c(c1)sc1c(-c3cc(Cc4ccccc4)ccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C24H15FNS.C21H22NSi.Ir/c25-18-9-10-19-20-7-4-8-21(24(20)27-23(19)15-18)22-14-17(11-12-26-22)13-16-5-2-1-3-6-16;1-23(2,3)21-16-22-20(18-12-8-5-9-13-18)15-19(21)14-17-10-6-4-7-11-17;/h1-7,9-12,14-15H,13H2;4-12,15-16H,14H2,1-3H3;/q2*-1; |
| InChIKey | JDCPNXUGMCURFU-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.17 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|