About (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate
(3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate (PubChem CID 162710728) has the molecular formula C9H15F3O3
and a molecular weight of 228.21 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate.
Analyze (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate?
The IUPAC name of (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate (CID 162710728) is (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate.
What is the SMILES notation for (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate?
The canonical SMILES for (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate is CC(C)(CO)COC(=O)CCC(F)(F)F.
What is the InChIKey of (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate?
The InChIKey is HVFZLNQBFGZMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O3/c1-8(2,5-13)6-15-7(14)3-4-9(10,11)12/h13H,3-6H2,1-2H3.
What are the key properties of (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate?
(3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate has a molecular weight of 228.21 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,2-dimethylpropyl) 4,4,4-trifluorobutanoate is sourced from PubChem (CID 162710728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).