C15H30O9 — CID 87076072
butane-1,1,1,4-tetrol;6-(3-hydroxy-2,2-dimethylpropoxy)-6-oxohexanoic acid (PubChem CID 87076072) has the molecular formula C15H30O9 and a molecular weight of 354.40 g/mol. Its IUPAC name is butane-1,1,1,4-tetrol;6-(3-hydroxy-2,2-dimethylpropoxy)-6-oxohexanoic acid.
| Compound Name | butane-1,1,1,4-tetrol;6-(3-hydroxy-2,2-dimethylpropoxy)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87076072 |
| Molecular Formula | C15H30O9 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | butane-1,1,1,4-tetrol;6-(3-hydroxy-2,2-dimethylpropoxy)-6-oxohexanoic acid |
| SMILES | CC(C)(CO)COC(=O)CCCCC(=O)O.OCCCC(O)(O)O |
| InChI | InChI=1S/C11H20O5.C4H10O4/c1-11(2,7-12)8-16-10(15)6-4-3-5-9(13)14;5-3-1-2-4(6,7)8/h12H,3-8H2,1-2H3,(H,13,14);5-8H,1-3H2 |
| InChIKey | JZCKDSRCDJKTQH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|