About 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one
2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one (PubChem CID 162711679) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one.
Analyze 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one?
The IUPAC name of 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one (CID 162711679) is 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one.
What is the SMILES notation for 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one?
The canonical SMILES for 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one is O=C1CN2CCNC2=CN1.
What is the InChIKey of 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one?
The InChIKey is BXMPFFLYMZSZCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c10-6-4-9-2-1-7-5(9)3-8-6/h3,7H,1-2,4H2,(H,8,10).
What are the key properties of 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one?
2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one has a molecular weight of 139.16 g/mol, XLogP of -1.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,7-tetrahydro-1H-imidazo[1,2-a]pyrazin-6-one is sourced from PubChem (CID 162711679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).