About 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one
7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one (PubChem CID 75089152) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one.
Analyze 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one?
The IUPAC name of 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one (CID 75089152) is 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one.
What is the SMILES notation for 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one?
The canonical SMILES for 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one is CN1C=CN2C=CNC2C1=O.
What is the InChIKey of 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one?
The InChIKey is LFXGGXJSDJRXKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c1-9-4-5-10-3-2-8-6(10)7(9)11/h2-6,8H,1H3.
What are the key properties of 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one?
7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one has a molecular weight of 151.17 g/mol, XLogP of -0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-one is sourced from PubChem (CID 75089152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).