C32H41N5O6 — CID 162712464
3-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 162712464) has the molecular formula C32H41N5O6 and a molecular weight of 591.71 g/mol. Its IUPAC name is 3-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 3-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 162712464 |
| Molecular Formula | C32H41N5O6 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 3-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4CCCC4C3(C(N)=O)[C@H](C[C@H]3CCNC3=O)C(=O)C(=O)NC3CCCCC3)cc12 |
| InChI | InChI=1S/C32H41N5O6/c1-43-26-12-6-11-24-21(26)16-25(36-24)30(41)37-17-19-7-5-10-22(19)32(37,31(33)42)23(15-18-13-14-34-28(18)39)27(38)29(40)35-20-8-3-2-4-9-20/h6,11-12,16,18-20,22-23,36H,2-5,7-10,13-15,17H2,1H3,(H2,33,42)(H,34,39)(H,35,40)/t18-,19?,22?,23-,32?/m1/s1 |
| InChIKey | YYAAGZPZNTUTJV-IXEJRHOWSA-N |
| XLogP | 2.43 |
| TPSA | 163.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|