C32H78O10RfSi8-2 — CID 162713136
bis(hydroxy-[[[[(E)-7-methanidyloxyhept-1-enyl]-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane);rutherfordium (PubChem CID 162713136) has the molecular formula C32H78O10RfSi8-2 and a molecular weight of 1114.65 g/mol. Its IUPAC name is bis(hydroxy-[[[[(E)-7-methanidyloxyhept-1-enyl]-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane);rutherfordium.
| Compound Name | bis(hydroxy-[[[[(E)-7-methanidyloxyhept-1-enyl]-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane);rutherfordium |
|---|---|
| PubChem CID | 162713136 |
| Molecular Formula | C32H78O10RfSi8-2 |
| Molecular Weight | 1114.65 g/mol |
| Exact Mass | 1113.50 |
| IUPAC Name | bis(hydroxy-[[[[(E)-7-methanidyloxyhept-1-enyl]-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane);rutherfordium |
| SMILES | [CH2-]OCCCCC/C=C/[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O.[CH2-]OCCCCC/C=C/[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O.[Rf] |
| InChI | InChI=1S/2C16H39O5Si4.Rf/c2*1-18-15-13-11-10-12-14-16-22(2,3)19-24(6,7)21-25(8,9)20-23(4,5)17;/h2*14,16-17H,1,10-13,15H2,2-9H3;/q2*-1;/b2*16-14+; |
| InChIKey | FKZKADQAZSCTJT-AOKILNOYSA-N |
| XLogP | 9.61 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.65 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|