About 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane
8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane (PubChem CID 162715222) has the molecular formula C21H24F2O3
and a molecular weight of 362.42 g/mol. Its IUPAC name is 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 162715222 |
| Molecular Formula | C21H24F2O3 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CCCOc1ccc2cc(C3CCC4(CC3)OCCO4)c(F)c(F)c2c1 |
| InChI | InChI=1S/C21H24F2O3/c1-2-9-24-16-4-3-15-12-17(19(22)20(23)18(15)13-16)14-5-7-21(8-6-14)25-10-11-26-21/h3-4,12-14H,2,5-11H2,1H3 |
| InChIKey | KNAOGYFBXHEULF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane (CID 162715222) is 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane is CCCOc1ccc2cc(C3CCC4(CC3)OCCO4)c(F)c(F)c2c1.
What is the InChIKey of 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is KNAOGYFBXHEULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2O3/c1-2-9-24-16-4-3-15-12-17(19(22)20(23)18(15)13-16)14-5-7-21(8-6-14)25-10-11-26-21/h3-4,12-14H,2,5-11H2,1H3.
What are the key properties of 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane?
8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 362.42 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,4-difluoro-6-propoxynaphthalen-2-yl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 162715222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).