C24H28F2O3 — CID 89429558
8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 89429558) has the molecular formula C24H28F2O3 and a molecular weight of 402.48 g/mol. Its IUPAC name is 8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 89429558 |
| Molecular Formula | C24H28F2O3 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | CCCCOc1ccc(-c2ccc(C3CCC4(CC3)OCCO4)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H28F2O3/c1-2-3-14-27-19-6-4-17(5-7-19)20-8-9-21(23(26)22(20)25)18-10-12-24(13-11-18)28-15-16-29-24/h4-9,18H,2-3,10-16H2,1H3 |
| InChIKey | AFVMDSYIZGHQJT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|