C24H28F2O4 — CID 89429554
8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 89429554) has the molecular formula C24H28F2O4 and a molecular weight of 418.48 g/mol. Its IUPAC name is 8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | 8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 89429554 |
| Molecular Formula | C24H28F2O4 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 8-[4-(4-butoxyphenyl)-2,3-difluorophenyl]-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | CCCCOc1ccc(-c2ccc(C3(O)CCC4(CC3)OCCO4)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H28F2O4/c1-2-3-14-28-18-6-4-17(5-7-18)19-8-9-20(22(26)21(19)25)23(27)10-12-24(13-11-23)29-15-16-30-24/h4-9,27H,2-3,10-16H2,1H3 |
| InChIKey | WWCCLEKKVQAZGT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|