C25H32F2O3 — CID 130176610
4-butoxy-1-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-4-methylcyclohexan-1-ol (PubChem CID 130176610) has the molecular formula C25H32F2O3 and a molecular weight of 418.52 g/mol. Its IUPAC name is 4-butoxy-1-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-4-methylcyclohexan-1-ol.
| Compound Name | 4-butoxy-1-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 130176610 |
| Molecular Formula | C25H32F2O3 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 4-butoxy-1-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-4-methylcyclohexan-1-ol |
| SMILES | CCCCOC1(C)CCC(O)(c2ccc(-c3ccc(OCC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C25H32F2O3/c1-4-6-17-30-24(3)13-15-25(28,16-14-24)19-9-7-18(8-10-19)20-11-12-21(29-5-2)23(27)22(20)26/h7-12,28H,4-6,13-17H2,1-3H3 |
| InChIKey | AIBFLJFRJWFJMQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|