C35H52O8 — CID 162716958
4-[1-[3,5-di(heptanoyl)-2,4,6-trihydroxyphenyl]-3-methylbutyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione (PubChem CID 162716958) has the molecular formula C35H52O8 and a molecular weight of 600.79 g/mol. Its IUPAC name is 4-[1-[3,5-di(heptanoyl)-2,4,6-trihydroxyphenyl]-3-methylbutyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione.
| Compound Name | 4-[1-[3,5-di(heptanoyl)-2,4,6-trihydroxyphenyl]-3-methylbutyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 162716958 |
| Molecular Formula | C35H52O8 |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | 4-[1-[3,5-di(heptanoyl)-2,4,6-trihydroxyphenyl]-3-methylbutyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
| SMILES | CCCCCCC(=O)c1c(O)c(C(=O)CCCCCC)c(O)c(C(CC(C)C)C2=C(O)C(C)(C)C(=O)C(C)(C)C2=O)c1O |
| InChI | InChI=1S/C35H52O8/c1-9-11-13-15-17-22(36)26-28(38)24(29(39)27(30(26)40)23(37)18-16-14-12-10-2)21(19-20(3)4)25-31(41)34(5,6)33(43)35(7,8)32(25)42/h20-21,38-41H,9-19H2,1-8H3 |
| InChIKey | URWSJJQGDDEVBU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|