C27H36O8 — CID 167370279
4-[(3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl)methyl]-2-hexanoyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 167370279) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is 4-[(3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl)methyl]-2-hexanoyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one.
| Compound Name | 4-[(3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl)methyl]-2-hexanoyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 167370279 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 4-[(3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylphenyl)methyl]-2-hexanoyl-3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | CCCCCC(=O)C1=C(O)C(Cc2c(O)c(C)c(OC)c(C(=O)CCC)c2O)=C(O)C(C)(C)C1=O |
| InChI | InChI=1S/C27H36O8/c1-7-9-10-12-18(29)20-23(32)16(25(33)27(4,5)26(20)34)13-15-21(30)14(3)24(35-6)19(22(15)31)17(28)11-8-2/h30-33H,7-13H2,1-6H3 |
| InChIKey | CWDRYIQAVCXVMF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|