C20H23N7O — CID 162717362
2-(2,3-dihydro-1H-inden-2-ylamino)-N-[4-(2H-triazol-4-yl)butyl]pyrimidine-5-carboxamide (PubChem CID 162717362) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[4-(2H-triazol-4-yl)butyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[4-(2H-triazol-4-yl)butyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 162717362 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[4-(2H-triazol-4-yl)butyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCCc1cn[nH]n1)c1cnc(NC2Cc3ccccc3C2)nc1 |
| InChI | InChI=1S/C20H23N7O/c28-19(21-8-4-3-7-17-13-24-27-26-17)16-11-22-20(23-12-16)25-18-9-14-5-1-2-6-15(14)10-18/h1-2,5-6,11-13,18H,3-4,7-10H2,(H,21,28)(H,22,23,25)(H,24,26,27) |
| InChIKey | UVHWATRHUUGYOJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|