C25H22N4OS — CID 162718253
[4-(5,6-diphenylpyrazin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 162718253) has the molecular formula C25H22N4OS and a molecular weight of 426.55 g/mol. Its IUPAC name is [4-(5,6-diphenylpyrazin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(5,6-diphenylpyrazin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 162718253 |
| Molecular Formula | C25H22N4OS |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [4-(5,6-diphenylpyrazin-2-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(c2cnc(-c3ccccc3)c(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C25H22N4OS/c30-25(21-12-7-17-31-21)29-15-13-28(14-16-29)22-18-26-23(19-8-3-1-4-9-19)24(27-22)20-10-5-2-6-11-20/h1-12,17-18H,13-16H2 |
| InChIKey | XGDHFACDPGTGDB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |