C23H22N4O2S — CID 46042022
(E)-3-phenyl-N-[6-[4-(thiophene-2-carbonyl)piperazin-1-yl]-3-pyridinyl]prop-2-enamide (PubChem CID 46042022) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is (E)-3-phenyl-N-[6-[4-(thiophene-2-carbonyl)piperazin-1-yl]-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[6-[4-(thiophene-2-carbonyl)piperazin-1-yl]-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 46042022 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (E)-3-phenyl-N-[6-[4-(thiophene-2-carbonyl)piperazin-1-yl]-3-pyridinyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccc(N2CCN(C(=O)c3cccs3)CC2)nc1 |
| InChI | InChI=1S/C23H22N4O2S/c28-22(11-8-18-5-2-1-3-6-18)25-19-9-10-21(24-17-19)26-12-14-27(15-13-26)23(29)20-7-4-16-30-20/h1-11,16-17H,12-15H2,(H,25,28)/b11-8+ |
| InChIKey | CJCYSNWKKUPURQ-DHZHZOJOSA-N |
| XLogP | 3.76 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|