C27H37N5O2 — CID 42850313
(E)-N-[6-[4-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]piperazin-1-yl]-3-pyridinyl]-3-phenylprop-2-enamide (PubChem CID 42850313) has the molecular formula C27H37N5O2 and a molecular weight of 463.63 g/mol. Its IUPAC name is (E)-N-[6-[4-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]piperazin-1-yl]-3-pyridinyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[6-[4-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]piperazin-1-yl]-3-pyridinyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42850313 |
| Molecular Formula | C27H37N5O2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | (E)-N-[6-[4-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]piperazin-1-yl]-3-pyridinyl]-3-phenylprop-2-enamide |
| SMILES | CC1CCN(CC(O)CN2CCN(c3ccc(NC(=O)/C=C/c4ccccc4)cn3)CC2)CC1 |
| InChI | InChI=1S/C27H37N5O2/c1-22-11-13-30(14-12-22)20-25(33)21-31-15-17-32(18-16-31)26-9-8-24(19-28-26)29-27(34)10-7-23-5-3-2-4-6-23/h2-10,19,22,25,33H,11-18,20-21H2,1H3,(H,29,34)/b10-7+ |
| InChIKey | OVXWIXFGHVONQY-JXMROGBWSA-N |
| XLogP | 2.95 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|