C35H32N4O2 — CID 162718953
4-[[4-[4-(1-methylindole-3-carbonyl)carbazol-9-yl]piperidin-1-yl]methyl]benzamide (PubChem CID 162718953) has the molecular formula C35H32N4O2 and a molecular weight of 540.67 g/mol. Its IUPAC name is 4-[[4-[4-(1-methylindole-3-carbonyl)carbazol-9-yl]piperidin-1-yl]methyl]benzamide.
| Compound Name | 4-[[4-[4-(1-methylindole-3-carbonyl)carbazol-9-yl]piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 162718953 |
| Molecular Formula | C35H32N4O2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 4-[[4-[4-(1-methylindole-3-carbonyl)carbazol-9-yl]piperidin-1-yl]methyl]benzamide |
| SMILES | Cn1cc(C(=O)c2cccc3c2c2ccccc2n3C2CCN(Cc3ccc(C(N)=O)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C35H32N4O2/c1-37-22-29(26-7-2-4-10-30(26)37)34(40)28-9-6-12-32-33(28)27-8-3-5-11-31(27)39(32)25-17-19-38(20-18-25)21-23-13-15-24(16-14-23)35(36)41/h2-16,22,25H,17-21H2,1H3,(H2,36,41) |
| InChIKey | SDFOUSCFRLXESG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |