C30H26BrFO4 — CID 162720813
5-(3-bromopropoxy)-10-fluoro-2,2-bis(4-methoxyphenyl)benzo[h]chromene (PubChem CID 162720813) has the molecular formula C30H26BrFO4 and a molecular weight of 549.44 g/mol. Its IUPAC name is 5-(3-bromopropoxy)-10-fluoro-2,2-bis(4-methoxyphenyl)benzo[h]chromene.
| Compound Name | 5-(3-bromopropoxy)-10-fluoro-2,2-bis(4-methoxyphenyl)benzo[h]chromene |
|---|---|
| PubChem CID | 162720813 |
| Molecular Formula | C30H26BrFO4 |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 5-(3-bromopropoxy)-10-fluoro-2,2-bis(4-methoxyphenyl)benzo[h]chromene |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(OCCCBr)cc4cccc(F)c4c3O2)cc1 |
| InChI | InChI=1S/C30H26BrFO4/c1-33-23-11-7-21(8-12-23)30(22-9-13-24(34-2)14-10-22)16-15-25-27(35-18-4-17-31)19-20-5-3-6-26(32)28(20)29(25)36-30/h3,5-16,19H,4,17-18H2,1-2H3 |
| InChIKey | ATQYXKGKXANVKV-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|