C18H19F2N7O2 — CID 162722753
2-[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]-2-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]ethanol (PubChem CID 162722753) has the molecular formula C18H19F2N7O2 and a molecular weight of 403.39 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]-2-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]ethanol.
| Compound Name | 2-[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]-2-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 162722753 |
| Molecular Formula | C18H19F2N7O2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]-2-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]ethanol |
| SMILES | N/C(=C\N(N)C(CO)c1ccc(-c2nnc(C(F)F)o2)cc1)c1ccc(N)nc1 |
| InChI | InChI=1S/C18H19F2N7O2/c19-16(20)18-26-25-17(29-18)11-3-1-10(2-4-11)14(9-28)27(23)8-13(21)12-5-6-15(22)24-7-12/h1-8,14,16,28H,9,21,23H2,(H2,22,24)/b13-8- |
| InChIKey | MALCJFKUZLBEIF-JYRVWZFOSA-N |
| XLogP | 1.82 |
| TPSA | 153.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|