C33H54N2O7 — CID 162724093
tert-butyl (3S,4R)-3-but-2-ynoyl-4-methylpiperidine-1-carboxylate;tert-butyl (5S)-2-but-2-ynoyl-5-propan-2-ylmorpholine-4-carboxylate;ethane (PubChem CID 162724093) has the molecular formula C33H54N2O7 and a molecular weight of 590.80 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-but-2-ynoyl-4-methylpiperidine-1-carboxylate;tert-butyl (5S)-2-but-2-ynoyl-5-propan-2-ylmorpholine-4-carboxylate;ethane.
| Compound Name | tert-butyl (3S,4R)-3-but-2-ynoyl-4-methylpiperidine-1-carboxylate;tert-butyl (5S)-2-but-2-ynoyl-5-propan-2-ylmorpholine-4-carboxylate;ethane |
|---|---|
| PubChem CID | 162724093 |
| Molecular Formula | C33H54N2O7 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.39 |
| IUPAC Name | tert-butyl (3S,4R)-3-but-2-ynoyl-4-methylpiperidine-1-carboxylate;tert-butyl (5S)-2-but-2-ynoyl-5-propan-2-ylmorpholine-4-carboxylate;ethane |
| SMILES | CC.CC#CC(=O)C1CN(C(=O)OC(C)(C)C)[C@@H](C(C)C)CO1.CC#CC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1C |
| InChI | InChI=1S/C16H25NO4.C15H23NO3.C2H6/c1-7-8-13(18)14-9-17(12(10-20-14)11(2)3)15(19)21-16(4,5)6;1-6-7-13(17)12-10-16(9-8-11(12)2)14(18)19-15(3,4)5;1-2/h11-12,14H,9-10H2,1-6H3;11-12H,8-10H2,1-5H3;1-2H3/t12-,14?;11-,12-;/m11./s1 |
| InChIKey | FXJCEENBXQUIBS-AQHUVBBQSA-N |
| XLogP | 5.74 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|