C11H19ClF3NO2 — CID 162724745
[4-(trifluoromethyl)cyclohexyl] 2-amino-2-methylpropanoate;hydrochloride (PubChem CID 162724745) has the molecular formula C11H19ClF3NO2 and a molecular weight of 289.73 g/mol. Its IUPAC name is [4-(trifluoromethyl)cyclohexyl] 2-amino-2-methylpropanoate;hydrochloride.
| Compound Name | [4-(trifluoromethyl)cyclohexyl] 2-amino-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 162724745 |
| Molecular Formula | C11H19ClF3NO2 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | [4-(trifluoromethyl)cyclohexyl] 2-amino-2-methylpropanoate;hydrochloride |
| SMILES | CC(C)(N)C(=O)OC1CCC(C(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C11H18F3NO2.ClH/c1-10(2,15)9(16)17-8-5-3-7(4-6-8)11(12,13)14;/h7-8H,3-6,15H2,1-2H3;1H |
| InChIKey | ZMKJQNKZBVMNHB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |