About 3-methylsulfanylheptane;propane
3-methylsulfanylheptane;propane (PubChem CID 162726510) has the molecular formula C11H26S
and a molecular weight of 190.40 g/mol. Its IUPAC name is 3-methylsulfanylheptane;propane.
Molecular Properties
| Compound Name | 3-methylsulfanylheptane;propane |
| PubChem CID | 162726510 |
| Molecular Formula | C11H26S |
| Molecular Weight | 190.40 g/mol |
| Exact Mass | 190.18 |
| IUPAC Name | 3-methylsulfanylheptane;propane |
| SMILES | CCC.CCCCC(CC)SC |
| InChI | InChI=1S/C8H18S.C3H8/c1-4-6-7-8(5-2)9-3;1-3-2/h8H,4-7H2,1-3H3;3H2,1-2H3 |
| InChIKey | SVYYRBMRZOEOOP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylsulfanylheptane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylheptane;propane?
The IUPAC name of 3-methylsulfanylheptane;propane (CID 162726510) is 3-methylsulfanylheptane;propane.
What is the SMILES notation for 3-methylsulfanylheptane;propane?
The canonical SMILES for 3-methylsulfanylheptane;propane is CCC.CCCCC(CC)SC.
What is the InChIKey of 3-methylsulfanylheptane;propane?
The InChIKey is SVYYRBMRZOEOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18S.C3H8/c1-4-6-7-8(5-2)9-3;1-3-2/h8H,4-7H2,1-3H3;3H2,1-2H3.
What are the key properties of 3-methylsulfanylheptane;propane?
3-methylsulfanylheptane;propane has a molecular weight of 190.40 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylheptane;propane is sourced from PubChem (CID 162726510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).