About S-heptan-3-yl ethanethioate
S-heptan-3-yl ethanethioate (PubChem CID 135010806) has the molecular formula C9H18OS
and a molecular weight of 174.31 g/mol. Its IUPAC name is S-heptan-3-yl ethanethioate.
Molecular Properties
| Compound Name | S-heptan-3-yl ethanethioate |
| PubChem CID | 135010806 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | S-heptan-3-yl ethanethioate |
| SMILES | CCCCC(CC)SC(C)=O |
| InChI | InChI=1S/C9H18OS/c1-4-6-7-9(5-2)11-8(3)10/h9H,4-7H2,1-3H3 |
| InChIKey | PJTMSPZTRNEQFI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-heptan-3-yl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-heptan-3-yl ethanethioate?
The IUPAC name of S-heptan-3-yl ethanethioate (CID 135010806) is S-heptan-3-yl ethanethioate.
What is the SMILES notation for S-heptan-3-yl ethanethioate?
The canonical SMILES for S-heptan-3-yl ethanethioate is CCCCC(CC)SC(C)=O.
What is the InChIKey of S-heptan-3-yl ethanethioate?
The InChIKey is PJTMSPZTRNEQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18OS/c1-4-6-7-9(5-2)11-8(3)10/h9H,4-7H2,1-3H3.
What are the key properties of S-heptan-3-yl ethanethioate?
S-heptan-3-yl ethanethioate has a molecular weight of 174.31 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-heptan-3-yl ethanethioate is sourced from PubChem (CID 135010806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).