About 2-acetylsulfanyloctanoic acid
2-acetylsulfanyloctanoic acid (PubChem CID 87865763) has the molecular formula C10H18O3S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-acetylsulfanyloctanoic acid.
Molecular Properties
| Compound Name | 2-acetylsulfanyloctanoic acid |
| PubChem CID | 87865763 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 2-acetylsulfanyloctanoic acid |
| SMILES | CCCCCCC(SC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H18O3S/c1-3-4-5-6-7-9(10(12)13)14-8(2)11/h9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | JWTITYMFJZOBFR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-acetylsulfanyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylsulfanyloctanoic acid?
The IUPAC name of 2-acetylsulfanyloctanoic acid (CID 87865763) is 2-acetylsulfanyloctanoic acid.
What is the SMILES notation for 2-acetylsulfanyloctanoic acid?
The canonical SMILES for 2-acetylsulfanyloctanoic acid is CCCCCCC(SC(C)=O)C(=O)O.
What is the InChIKey of 2-acetylsulfanyloctanoic acid?
The InChIKey is JWTITYMFJZOBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3S/c1-3-4-5-6-7-9(10(12)13)14-8(2)11/h9H,3-7H2,1-2H3,(H,12,13).
What are the key properties of 2-acetylsulfanyloctanoic acid?
2-acetylsulfanyloctanoic acid has a molecular weight of 218.32 g/mol, XLogP of 2.69, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylsulfanyloctanoic acid is sourced from PubChem (CID 87865763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).