About S-pentadecan-7-yl ethanethioate
S-pentadecan-7-yl ethanethioate (PubChem CID 171608325) has the molecular formula C17H34OS
and a molecular weight of 286.52 g/mol. Its IUPAC name is S-pentadecan-7-yl ethanethioate.
Molecular Properties
| Compound Name | S-pentadecan-7-yl ethanethioate |
| PubChem CID | 171608325 |
| Molecular Formula | C17H34OS |
| Molecular Weight | 286.52 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | S-pentadecan-7-yl ethanethioate |
| SMILES | CCCCCCCCC(CCCCCC)SC(C)=O |
| InChI | InChI=1S/C17H34OS/c1-4-6-8-10-11-13-15-17(19-16(3)18)14-12-9-7-5-2/h17H,4-15H2,1-3H3 |
| InChIKey | OJKJTJKDTDTKMD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pentadecan-7-yl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pentadecan-7-yl ethanethioate?
The IUPAC name of S-pentadecan-7-yl ethanethioate (CID 171608325) is S-pentadecan-7-yl ethanethioate.
What is the SMILES notation for S-pentadecan-7-yl ethanethioate?
The canonical SMILES for S-pentadecan-7-yl ethanethioate is CCCCCCCCC(CCCCCC)SC(C)=O.
What is the InChIKey of S-pentadecan-7-yl ethanethioate?
The InChIKey is OJKJTJKDTDTKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34OS/c1-4-6-8-10-11-13-15-17(19-16(3)18)14-12-9-7-5-2/h17H,4-15H2,1-3H3.
What are the key properties of S-pentadecan-7-yl ethanethioate?
S-pentadecan-7-yl ethanethioate has a molecular weight of 286.52 g/mol, XLogP of 6.36, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-pentadecan-7-yl ethanethioate is sourced from PubChem (CID 171608325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).