C18H22Cl2N4O4S — CID 162727439
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-[2-(2-methoxyethoxy)ethylamino]sulfanyl-4-methylphenyl]acetamide (PubChem CID 162727439) has the molecular formula C18H22Cl2N4O4S and a molecular weight of 461.37 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-[2-(2-methoxyethoxy)ethylamino]sulfanyl-4-methylphenyl]acetamide.
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-[2-(2-methoxyethoxy)ethylamino]sulfanyl-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 162727439 |
| Molecular Formula | C18H22Cl2N4O4S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-[2-(2-methoxyethoxy)ethylamino]sulfanyl-4-methylphenyl]acetamide |
| SMILES | COCCOCCNSc1cc(NC(=O)Cn2ncc(Cl)c(Cl)c2=O)ccc1C |
| InChI | InChI=1S/C18H22Cl2N4O4S/c1-12-3-4-13(9-15(12)29-22-5-6-28-8-7-27-2)23-16(25)11-24-18(26)17(20)14(19)10-21-24/h3-4,9-10,22H,5-8,11H2,1-2H3,(H,23,25) |
| InChIKey | KELVXLCKKJNETQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|