C20H32FN5O3 — CID 162729888
ethyl 2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-4-fluoro-3-pyridinyl]piperidin-3-yl]acetate (PubChem CID 162729888) has the molecular formula C20H32FN5O3 and a molecular weight of 409.51 g/mol. Its IUPAC name is ethyl 2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-4-fluoro-3-pyridinyl]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-4-fluoro-3-pyridinyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 162729888 |
| Molecular Formula | C20H32FN5O3 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | ethyl 2-[1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-4-fluoro-3-pyridinyl]piperidin-3-yl]acetate |
| SMILES | CCOC(=O)CC1CCCN(c2c(F)cc(/C(N)=C(\CO)N(C)N)nc2CC)C1 |
| InChI | InChI=1S/C20H32FN5O3/c1-4-15-20(26-8-6-7-13(11-26)9-18(28)29-5-2)14(21)10-16(24-15)19(22)17(12-27)25(3)23/h10,13,27H,4-9,11-12,22-23H2,1-3H3/b19-17- |
| InChIKey | MIFRYLGAQIZKOJ-ZPHPHTNESA-N |
| XLogP | 1.38 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|