C19H31F2N5O3 — CID 162730038
(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate (PubChem CID 162730038) has the molecular formula C19H31F2N5O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is (Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate.
| Compound Name | (Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate |
|---|---|
| PubChem CID | 162730038 |
| Molecular Formula | C19H31F2N5O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate |
| SMILES | CCc1nc(/C(N)=C(\CO)N(C)N)ccc1N1CCCC(F)(F)C1.COC(C)=O |
| InChI | InChI=1S/C16H25F2N5O.C3H6O2/c1-3-11-13(23-8-4-7-16(17,18)10-23)6-5-12(21-11)15(19)14(9-24)22(2)20;1-3(4)5-2/h5-6,24H,3-4,7-10,19-20H2,1-2H3;1-2H3/b15-14-; |
| InChIKey | CVECUIGHURQGLC-BGWNKZQTSA-N |
| XLogP | 1.48 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|