C18H29F2N5O3 — CID 162729781
(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-methyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate (PubChem CID 162729781) has the molecular formula C18H29F2N5O3 and a molecular weight of 401.46 g/mol. Its IUPAC name is (Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-methyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate.
| Compound Name | (Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-methyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate |
|---|---|
| PubChem CID | 162729781 |
| Molecular Formula | C18H29F2N5O3 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-methyl-2-pyridinyl]prop-2-en-1-ol;methyl acetate |
| SMILES | COC(C)=O.Cc1nc(/C(N)=C(\CO)N(C)N)ccc1N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C15H23F2N5O.C3H6O2/c1-10-12(22-7-3-6-15(16,17)9-22)5-4-11(20-10)14(18)13(8-23)21(2)19;1-3(4)5-2/h4-5,23H,3,6-9,18-19H2,1-2H3;1-2H3/b14-13-; |
| InChIKey | XQODZQVQJWTGMO-HPWRNOGASA-N |
| XLogP | 1.23 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|