C28H45F3N6O3 — CID 162729783
(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;formic acid;propane (PubChem CID 162729783) has the molecular formula C28H45F3N6O3 and a molecular weight of 570.70 g/mol. Its IUPAC name is (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;formic acid;propane.
| Compound Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;formic acid;propane |
|---|---|
| PubChem CID | 162729783 |
| Molecular Formula | C28H45F3N6O3 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;formic acid;propane |
| SMILES | CCC.CCCC(/C=C\C=O)=C/N(C)C/C(=C(/N)c1ccc(N2CCCCC2)c(C(F)(F)F)n1)N(C)N.O=CO |
| InChI | InChI=1S/C24H35F3N6O.C3H8.CH2O2/c1-4-9-18(10-8-15-34)16-31(2)17-21(32(3)29)22(28)19-11-12-20(23(30-19)24(25,26)27)33-13-6-5-7-14-33;1-3-2;2-1-3/h8,10-12,15-16H,4-7,9,13-14,17,28-29H2,1-3H3;3H2,1-2H3;1H,(H,2,3)/b10-8-,18-16-,22-21-;; |
| InChIKey | DTFIYGLOVYSARR-FKWJGINYSA-N |
| XLogP | 5.01 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|