C14H16F2N4O — CID 137484328
(2Z,4E)-5-[2-(2,6-difluoro-3-pyridinyl)hydrazinyl]-4-(dimethylaminomethylidene)hexa-2,5-dienal (PubChem CID 137484328) has the molecular formula C14H16F2N4O and a molecular weight of 294.31 g/mol. Its IUPAC name is (2Z,4E)-5-[2-(2,6-difluoro-3-pyridinyl)hydrazinyl]-4-(dimethylaminomethylidene)hexa-2,5-dienal.
| Compound Name | (2Z,4E)-5-[2-(2,6-difluoro-3-pyridinyl)hydrazinyl]-4-(dimethylaminomethylidene)hexa-2,5-dienal |
|---|---|
| PubChem CID | 137484328 |
| Molecular Formula | C14H16F2N4O |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2Z,4E)-5-[2-(2,6-difluoro-3-pyridinyl)hydrazinyl]-4-(dimethylaminomethylidene)hexa-2,5-dienal |
| SMILES | C=C(NNc1ccc(F)nc1F)C(/C=C\C=O)=C/N(C)C |
| InChI | InChI=1S/C14H16F2N4O/c1-10(11(5-4-8-21)9-20(2)3)18-19-12-6-7-13(15)17-14(12)16/h4-9,18-19H,1H2,2-3H3/b5-4-,11-9+ |
| InChIKey | JUSOYKSDEKZGEH-JHGYFVHDSA-N |
| XLogP | 1.99 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|